C15H9ClF2N2O2S2 — CID 7941095
2-chloro-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]benzenesulfonamide (PubChem CID 7941095) has the molecular formula C15H9ClF2N2O2S2 and a molecular weight of 386.83 g/mol. Its IUPAC name is 2-chloro-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]benzenesulfonamide.
| Compound Name | 2-chloro-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 7941095 |
| Molecular Formula | C15H9ClF2N2O2S2 |
| Molecular Weight | 386.83 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 2-chloro-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc(-c2ccc(F)c(F)c2)cs1)c1ccccc1Cl |
| InChI | InChI=1S/C15H9ClF2N2O2S2/c16-10-3-1-2-4-14(10)24(21,22)20-15-19-13(8-23-15)9-5-6-11(17)12(18)7-9/h1-8H,(H,19,20) |
| InChIKey | IOGHSVBZLRLSKT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.83 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|