C14H11F2N3O3S2 — CID 8603622
N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 8603622) has the molecular formula C14H11F2N3O3S2 and a molecular weight of 371.39 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 8603622 |
| Molecular Formula | C14H11F2N3O3S2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)Nc1nc(-c2ccc(F)c(F)c2)cs1 |
| InChI | InChI=1S/C14H11F2N3O3S2/c1-7-13(8(2)22-18-7)24(20,21)19-14-17-12(6-23-14)9-3-4-10(15)11(16)5-9/h3-6H,1-2H3,(H,17,19) |
| InChIKey | NGMNCMXQCUQMTC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|