C11H11F2N3O3S — CID 43550970
N-(5-amino-2,4-difluorophenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 43550970) has the molecular formula C11H11F2N3O3S and a molecular weight of 303.29 g/mol. Its IUPAC name is N-(5-amino-2,4-difluorophenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-(5-amino-2,4-difluorophenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 43550970 |
| Molecular Formula | C11H11F2N3O3S |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | N-(5-amino-2,4-difluorophenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)Nc1cc(N)c(F)cc1F |
| InChI | InChI=1S/C11H11F2N3O3S/c1-5-11(6(2)19-15-5)20(17,18)16-10-4-9(14)7(12)3-8(10)13/h3-4,16H,14H2,1-2H3 |
| InChIKey | IAANTDZOTJBVDU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|