C12H13N3O5S — CID 63117138
3-amino-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]benzoic acid (PubChem CID 63117138) has the molecular formula C12H13N3O5S and a molecular weight of 311.32 g/mol. Its IUPAC name is 3-amino-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]benzoic acid.
| Compound Name | 3-amino-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 63117138 |
| Molecular Formula | C12H13N3O5S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 3-amino-4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]benzoic acid |
| SMILES | Cc1noc(C)c1S(=O)(=O)Nc1ccc(C(=O)O)cc1N |
| InChI | InChI=1S/C12H13N3O5S/c1-6-11(7(2)20-14-6)21(18,19)15-10-4-3-8(12(16)17)5-9(10)13/h3-5,15H,13H2,1-2H3,(H,16,17) |
| InChIKey | DOHHIQBQLIYPBD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 135.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|