C17H16FN3O3S — CID 112986818
N-[4-(2-fluoroanilino)phenyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 112986818) has the molecular formula C17H16FN3O3S and a molecular weight of 361.40 g/mol. Its IUPAC name is N-[4-(2-fluoroanilino)phenyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[4-(2-fluoroanilino)phenyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 112986818 |
| Molecular Formula | C17H16FN3O3S |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | N-[4-(2-fluoroanilino)phenyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)Nc1ccc(Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C17H16FN3O3S/c1-11-17(12(2)24-20-11)25(22,23)21-14-9-7-13(8-10-14)19-16-6-4-3-5-15(16)18/h3-10,19,21H,1-2H3 |
| InChIKey | RSSPAQKUBOOOJT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |