C18H19N3O3S — CID 112986072
3,5-dimethyl-N-[4-(4-methylanilino)phenyl]-1,2-oxazole-4-sulfonamide (PubChem CID 112986072) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is 3,5-dimethyl-N-[4-(4-methylanilino)phenyl]-1,2-oxazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-[4-(4-methylanilino)phenyl]-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 112986072 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 3,5-dimethyl-N-[4-(4-methylanilino)phenyl]-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1ccc(Nc2ccc(NS(=O)(=O)c3c(C)noc3C)cc2)cc1 |
| InChI | InChI=1S/C18H19N3O3S/c1-12-4-6-15(7-5-12)19-16-8-10-17(11-9-16)21-25(22,23)18-13(2)20-24-14(18)3/h4-11,19,21H,1-3H3 |
| InChIKey | MOPPMIWALDXWEC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |