C13H16N2O3S2 — CID 110778642
N-(4-ethylsulfanylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 110778642) has the molecular formula C13H16N2O3S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is N-(4-ethylsulfanylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-(4-ethylsulfanylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 110778642 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | N-(4-ethylsulfanylphenyl)-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | CCSc1ccc(NS(=O)(=O)c2c(C)noc2C)cc1 |
| InChI | InChI=1S/C13H16N2O3S2/c1-4-19-12-7-5-11(6-8-12)15-20(16,17)13-9(2)14-18-10(13)3/h5-8,15H,4H2,1-3H3 |
| InChIKey | CCUKOFWWWGPKGQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |