C19H21N3O3S — CID 112986500
N-[4-(2-ethylanilino)phenyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 112986500) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is N-[4-(2-ethylanilino)phenyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[4-(2-ethylanilino)phenyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 112986500 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[4-(2-ethylanilino)phenyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | CCc1ccccc1Nc1ccc(NS(=O)(=O)c2c(C)noc2C)cc1 |
| InChI | InChI=1S/C19H21N3O3S/c1-4-15-7-5-6-8-18(15)20-16-9-11-17(12-10-16)22-26(23,24)19-13(2)21-25-14(19)3/h5-12,20,22H,4H2,1-3H3 |
| InChIKey | NBQSUEXGTBZWCY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |