C16H10F4N2O2S2 — CID 25024188
N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 25024188) has the molecular formula C16H10F4N2O2S2 and a molecular weight of 402.39 g/mol. Its IUPAC name is N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 25024188 |
| Molecular Formula | C16H10F4N2O2S2 |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | N-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc(-c2ccc(F)cc2)cs1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H10F4N2O2S2/c17-11-7-5-10(6-8-11)13-9-25-15(21-13)22-26(23,24)14-4-2-1-3-12(14)16(18,19)20/h1-9H,(H,21,22) |
| InChIKey | RDYXMNOXRHHUTD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|