C10H8F3N3O2S2 — CID 43602534
N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 43602534) has the molecular formula C10H8F3N3O2S2 and a molecular weight of 323.32 g/mol. Its IUPAC name is N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 43602534 |
| Molecular Formula | C10H8F3N3O2S2 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | N-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | Nc1ccc(-c2csc(NS(=O)(=O)C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C10H8F3N3O2S2/c11-10(12,13)20(17,18)16-9-15-8(5-19-9)6-1-3-7(14)4-2-6/h1-5H,14H2,(H,15,16) |
| InChIKey | DEBFFRSPQNCMQL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|