C13H14N4OS — CID 62698343
1-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-3-cyclopropylurea (PubChem CID 62698343) has the molecular formula C13H14N4OS and a molecular weight of 274.35 g/mol. Its IUPAC name is 1-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-3-cyclopropylurea.
| Compound Name | 1-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-3-cyclopropylurea |
|---|---|
| PubChem CID | 62698343 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-3-cyclopropylurea |
| SMILES | Nc1ccc(-c2csc(NC(=O)NC3CC3)n2)cc1 |
| InChI | InChI=1S/C13H14N4OS/c14-9-3-1-8(2-4-9)11-7-19-13(16-11)17-12(18)15-10-5-6-10/h1-4,7,10H,5-6,14H2,(H2,15,16,17,18) |
| InChIKey | ONFCAKUZUMIWKF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|