C12H14N4O2S2 — CID 114804526
4-(4-aminophenyl)-N-(cyclopropylsulfamoyl)-1,3-thiazol-2-amine (PubChem CID 114804526) has the molecular formula C12H14N4O2S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 4-(4-aminophenyl)-N-(cyclopropylsulfamoyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(4-aminophenyl)-N-(cyclopropylsulfamoyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 114804526 |
| Molecular Formula | C12H14N4O2S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 4-(4-aminophenyl)-N-(cyclopropylsulfamoyl)-1,3-thiazol-2-amine |
| SMILES | Nc1ccc(-c2csc(NS(=O)(=O)NC3CC3)n2)cc1 |
| InChI | InChI=1S/C12H14N4O2S2/c13-9-3-1-8(2-4-9)11-7-19-12(14-11)16-20(17,18)15-10-5-6-10/h1-4,7,10,15H,5-6,13H2,(H,14,16) |
| InChIKey | WPDDVBNVQGYPAF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|