C12H13N3O2S2 — CID 39404850
3-(2-amino-1,3-thiazol-4-yl)-N-cyclopropylbenzenesulfonamide (PubChem CID 39404850) has the molecular formula C12H13N3O2S2 and a molecular weight of 295.39 g/mol. Its IUPAC name is 3-(2-amino-1,3-thiazol-4-yl)-N-cyclopropylbenzenesulfonamide.
| Compound Name | 3-(2-amino-1,3-thiazol-4-yl)-N-cyclopropylbenzenesulfonamide |
|---|---|
| PubChem CID | 39404850 |
| Molecular Formula | C12H13N3O2S2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 3-(2-amino-1,3-thiazol-4-yl)-N-cyclopropylbenzenesulfonamide |
| SMILES | Nc1nc(-c2cccc(S(=O)(=O)NC3CC3)c2)cs1 |
| InChI | InChI=1S/C12H13N3O2S2/c13-12-14-11(7-18-12)8-2-1-3-10(6-8)19(16,17)15-9-4-5-9/h1-3,6-7,9,15H,4-5H2,(H2,13,14) |
| InChIKey | DZYCKOMUUUELCT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |