C15H17N3O2S — CID 140766860
3-(6-amino-3-methyl-2-pyridinyl)-N-cyclopropylbenzenesulfonamide (PubChem CID 140766860) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 3-(6-amino-3-methyl-2-pyridinyl)-N-cyclopropylbenzenesulfonamide.
| Compound Name | 3-(6-amino-3-methyl-2-pyridinyl)-N-cyclopropylbenzenesulfonamide |
|---|---|
| PubChem CID | 140766860 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 3-(6-amino-3-methyl-2-pyridinyl)-N-cyclopropylbenzenesulfonamide |
| SMILES | Cc1ccc(N)nc1-c1cccc(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C15H17N3O2S/c1-10-5-8-14(16)17-15(10)11-3-2-4-13(9-11)21(19,20)18-12-6-7-12/h2-5,8-9,12,18H,6-7H2,1H3,(H2,16,17) |
| InChIKey | YZZYBVGPRURZIY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |