C13H14N4O2S — CID 178030384
3-(6-aminopyridazin-3-yl)-N-cyclopropylbenzenesulfonamide (PubChem CID 178030384) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is 3-(6-aminopyridazin-3-yl)-N-cyclopropylbenzenesulfonamide.
| Compound Name | 3-(6-aminopyridazin-3-yl)-N-cyclopropylbenzenesulfonamide |
|---|---|
| PubChem CID | 178030384 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 3-(6-aminopyridazin-3-yl)-N-cyclopropylbenzenesulfonamide |
| SMILES | Nc1ccc(-c2cccc(S(=O)(=O)NC3CC3)c2)nn1 |
| InChI | InChI=1S/C13H14N4O2S/c14-13-7-6-12(15-16-13)9-2-1-3-11(8-9)20(18,19)17-10-4-5-10/h1-3,6-8,10,17H,4-5H2,(H2,14,16) |
| InChIKey | RWVWXKPNQDYFAX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |