C10H12N4O2S2 — CID 114804253
2-N-(cyclopropylsulfamoyl)-1,3-benzothiazole-2,6-diamine (PubChem CID 114804253) has the molecular formula C10H12N4O2S2 and a molecular weight of 284.37 g/mol. Its IUPAC name is 2-N-(cyclopropylsulfamoyl)-1,3-benzothiazole-2,6-diamine.
| Compound Name | 2-N-(cyclopropylsulfamoyl)-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 114804253 |
| Molecular Formula | C10H12N4O2S2 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-N-(cyclopropylsulfamoyl)-1,3-benzothiazole-2,6-diamine |
| SMILES | Nc1ccc2nc(NS(=O)(=O)NC3CC3)sc2c1 |
| InChI | InChI=1S/C10H12N4O2S2/c11-6-1-4-8-9(5-6)17-10(12-8)14-18(15,16)13-7-2-3-7/h1,4-5,7,13H,2-3,11H2,(H,12,14) |
| InChIKey | JCANQZVYGGBVKT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|