C14H19N3S — CID 63231366
2-N-(4-methylcyclohexyl)-1,3-benzothiazole-2,6-diamine (PubChem CID 63231366) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 2-N-(4-methylcyclohexyl)-1,3-benzothiazole-2,6-diamine.
| Compound Name | 2-N-(4-methylcyclohexyl)-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 63231366 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-N-(4-methylcyclohexyl)-1,3-benzothiazole-2,6-diamine |
| SMILES | CC1CCC(Nc2nc3ccc(N)cc3s2)CC1 |
| InChI | InChI=1S/C14H19N3S/c1-9-2-5-11(6-3-9)16-14-17-12-7-4-10(15)8-13(12)18-14/h4,7-9,11H,2-3,5-6,15H2,1H3,(H,16,17) |
| InChIKey | YFBNRUVHMMBBKP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|