C13H18N4O2S2 — CID 114810398
4-[4-(aminomethyl)phenyl]-N-(propylsulfamoyl)-1,3-thiazol-2-amine (PubChem CID 114810398) has the molecular formula C13H18N4O2S2 and a molecular weight of 326.45 g/mol. Its IUPAC name is 4-[4-(aminomethyl)phenyl]-N-(propylsulfamoyl)-1,3-thiazol-2-amine.
| Compound Name | 4-[4-(aminomethyl)phenyl]-N-(propylsulfamoyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 114810398 |
| Molecular Formula | C13H18N4O2S2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 4-[4-(aminomethyl)phenyl]-N-(propylsulfamoyl)-1,3-thiazol-2-amine |
| SMILES | CCCNS(=O)(=O)Nc1nc(-c2ccc(CN)cc2)cs1 |
| InChI | InChI=1S/C13H18N4O2S2/c1-2-7-15-21(18,19)17-13-16-12(9-20-13)11-5-3-10(8-14)4-6-11/h3-6,9,15H,2,7-8,14H2,1H3,(H,16,17) |
| InChIKey | PGQJNIBSANXQDE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |