C16H23N3O2S2 — CID 9343482
N,N-diethyl-4-[2-(propylamino)-1,3-thiazol-4-yl]benzenesulfonamide (PubChem CID 9343482) has the molecular formula C16H23N3O2S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is N,N-diethyl-4-[2-(propylamino)-1,3-thiazol-4-yl]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[2-(propylamino)-1,3-thiazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 9343482 |
| Molecular Formula | C16H23N3O2S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N,N-diethyl-4-[2-(propylamino)-1,3-thiazol-4-yl]benzenesulfonamide |
| SMILES | CCCNc1nc(-c2ccc(S(=O)(=O)N(CC)CC)cc2)cs1 |
| InChI | InChI=1S/C16H23N3O2S2/c1-4-11-17-16-18-15(12-22-16)13-7-9-14(10-8-13)23(20,21)19(5-2)6-3/h7-10,12H,4-6,11H2,1-3H3,(H,17,18) |
| InChIKey | MBRYLLFZTAPDLP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |