C15H20N2OS — CID 63473179
4-(4-propoxyphenyl)-N-propyl-1,3-thiazol-2-amine (PubChem CID 63473179) has the molecular formula C15H20N2OS and a molecular weight of 276.41 g/mol. Its IUPAC name is 4-(4-propoxyphenyl)-N-propyl-1,3-thiazol-2-amine.
| Compound Name | 4-(4-propoxyphenyl)-N-propyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 63473179 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 4-(4-propoxyphenyl)-N-propyl-1,3-thiazol-2-amine |
| SMILES | CCCNc1nc(-c2ccc(OCCC)cc2)cs1 |
| InChI | InChI=1S/C15H20N2OS/c1-3-9-16-15-17-14(11-19-15)12-5-7-13(8-6-12)18-10-4-2/h5-8,11H,3-4,9-10H2,1-2H3,(H,16,17) |
| InChIKey | BDWUVIVFXCGBKI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |