C12H15N3O2S — CID 95471163
[4-[4-(2-methoxyethoxy)phenyl]-1,3-thiazol-2-yl]hydrazine (PubChem CID 95471163) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is [4-[4-(2-methoxyethoxy)phenyl]-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [4-[4-(2-methoxyethoxy)phenyl]-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 95471163 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | [4-[4-(2-methoxyethoxy)phenyl]-1,3-thiazol-2-yl]hydrazine |
| SMILES | COCCOc1ccc(-c2csc(NN)n2)cc1 |
| InChI | InChI=1S/C12H15N3O2S/c1-16-6-7-17-10-4-2-9(3-5-10)11-8-18-12(14-11)15-13/h2-5,8H,6-7,13H2,1H3,(H,14,15) |
| InChIKey | DQCJNDOMEXYNKS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|