C20H14N4O8S4 — CID 3328320
2-[[4-[2-[(2-carboxyphenyl)sulfonylamino]-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]sulfamoyl]benzoic acid (PubChem CID 3328320) has the molecular formula C20H14N4O8S4 and a molecular weight of 566.62 g/mol. Its IUPAC name is 2-[[4-[2-[(2-carboxyphenyl)sulfonylamino]-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]sulfamoyl]benzoic acid.
| Compound Name | 2-[[4-[2-[(2-carboxyphenyl)sulfonylamino]-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 3328320 |
| Molecular Formula | C20H14N4O8S4 |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 565.97 |
| IUPAC Name | 2-[[4-[2-[(2-carboxyphenyl)sulfonylamino]-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1S(=O)(=O)Nc1nc(-c2csc(NS(=O)(=O)c3ccccc3C(=O)O)n2)cs1 |
| InChI | InChI=1S/C20H14N4O8S4/c25-17(26)11-5-1-3-7-15(11)35(29,30)23-19-21-13(9-33-19)14-10-34-20(22-14)24-36(31,32)16-8-4-2-6-12(16)18(27)28/h1-10H,(H,21,23)(H,22,24)(H,25,26)(H,27,28) |
| InChIKey | ZSKHJDNBCLQCQC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 192.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|