C13H16N2O3S2 — CID 81241206
N-(4-tert-butyl-1,3-thiazol-2-yl)-2-hydroxybenzenesulfonamide (PubChem CID 81241206) has the molecular formula C13H16N2O3S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-2-hydroxybenzenesulfonamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 81241206 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-2-hydroxybenzenesulfonamide |
| SMILES | CC(C)(C)c1csc(NS(=O)(=O)c2ccccc2O)n1 |
| InChI | InChI=1S/C13H16N2O3S2/c1-13(2,3)11-8-19-12(14-11)15-20(17,18)10-7-5-4-6-9(10)16/h4-8,16H,1-3H3,(H,14,15) |
| InChIKey | XEFDSXQZABMFDH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |