C13H15ClN2O2S2 — CID 4527165
N-(4-tert-butyl-1,3-thiazol-2-yl)-3-chlorobenzenesulfonamide (PubChem CID 4527165) has the molecular formula C13H15ClN2O2S2 and a molecular weight of 330.86 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-3-chlorobenzenesulfonamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-3-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 4527165 |
| Molecular Formula | C13H15ClN2O2S2 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-3-chlorobenzenesulfonamide |
| SMILES | CC(C)(C)c1csc(NS(=O)(=O)c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C13H15ClN2O2S2/c1-13(2,3)11-8-19-12(15-11)16-20(17,18)10-6-4-5-9(14)7-10/h4-8H,1-3H3,(H,15,16) |
| InChIKey | IHYMPPITTSFBJV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |