C15H12N2O5S3 — CID 4965787
4-methoxy-3-[(4-thiophen-2-yl-1,3-thiazol-2-yl)sulfamoyl]benzoic acid (PubChem CID 4965787) has the molecular formula C15H12N2O5S3 and a molecular weight of 396.47 g/mol. Its IUPAC name is 4-methoxy-3-[(4-thiophen-2-yl-1,3-thiazol-2-yl)sulfamoyl]benzoic acid.
| Compound Name | 4-methoxy-3-[(4-thiophen-2-yl-1,3-thiazol-2-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 4965787 |
| Molecular Formula | C15H12N2O5S3 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 4-methoxy-3-[(4-thiophen-2-yl-1,3-thiazol-2-yl)sulfamoyl]benzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1S(=O)(=O)Nc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C15H12N2O5S3/c1-22-11-5-4-9(14(18)19)7-13(11)25(20,21)17-15-16-10(8-24-15)12-3-2-6-23-12/h2-8H,1H3,(H,16,17)(H,18,19) |
| InChIKey | UEYRRFCWIIDYOL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|