C22H23N3O4S3 — CID 29176160
(E)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 29176160) has the molecular formula C22H23N3O4S3 and a molecular weight of 489.64 g/mol. Its IUPAC name is (E)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 29176160 |
| Molecular Formula | C22H23N3O4S3 |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | (E)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2nc(-c3cccs3)cs2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C22H23N3O4S3/c1-29-18-9-7-16(14-20(18)32(27,28)25-11-3-2-4-12-25)8-10-21(26)24-22-23-17(15-31-22)19-6-5-13-30-19/h5-10,13-15H,2-4,11-12H2,1H3,(H,23,24,26)/b10-8+ |
| InChIKey | KMYHAZQFPICLTM-CSKARUKUSA-N |
| XLogP | 4.71 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|