C15H13N3O3S3 — CID 5058907
N-[4-[(4-thiophen-2-yl-1,3-thiazol-2-yl)sulfamoyl]phenyl]acetamide (PubChem CID 5058907) has the molecular formula C15H13N3O3S3 and a molecular weight of 379.49 g/mol. Its IUPAC name is N-[4-[(4-thiophen-2-yl-1,3-thiazol-2-yl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(4-thiophen-2-yl-1,3-thiazol-2-yl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 5058907 |
| Molecular Formula | C15H13N3O3S3 |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | N-[4-[(4-thiophen-2-yl-1,3-thiazol-2-yl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2nc(-c3cccs3)cs2)cc1 |
| InChI | InChI=1S/C15H13N3O3S3/c1-10(19)16-11-4-6-12(7-5-11)24(20,21)18-15-17-13(9-23-15)14-3-2-8-22-14/h2-9H,1H3,(H,16,19)(H,17,18) |
| InChIKey | JARQFTXYAHMYNI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|