C17H13Cl2N3O3S2 — CID 13219372
N-[4-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]sulfamoyl]phenyl]acetamide (PubChem CID 13219372) has the molecular formula C17H13Cl2N3O3S2 and a molecular weight of 442.35 g/mol. Its IUPAC name is N-[4-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 13219372 |
| Molecular Formula | C17H13Cl2N3O3S2 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 440.98 |
| IUPAC Name | N-[4-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2nc(-c3ccc(Cl)cc3Cl)cs2)cc1 |
| InChI | InChI=1S/C17H13Cl2N3O3S2/c1-10(23)20-12-3-5-13(6-4-12)27(24,25)22-17-21-16(9-26-17)14-7-2-11(18)8-15(14)19/h2-9H,1H3,(H,20,23)(H,21,22) |
| InChIKey | AGWMIHVZJCWUGQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|