C15H11ClN2O4S2 — CID 3009164
4-chloro-N-[4-(2,5-dihydroxyphenyl)-1,3-thiazol-2-yl]benzenesulfonamide (PubChem CID 3009164) has the molecular formula C15H11ClN2O4S2 and a molecular weight of 382.85 g/mol. Its IUPAC name is 4-chloro-N-[4-(2,5-dihydroxyphenyl)-1,3-thiazol-2-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[4-(2,5-dihydroxyphenyl)-1,3-thiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3009164 |
| Molecular Formula | C15H11ClN2O4S2 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 4-chloro-N-[4-(2,5-dihydroxyphenyl)-1,3-thiazol-2-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nc(-c2cc(O)ccc2O)cs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H11ClN2O4S2/c16-9-1-4-11(5-2-9)24(21,22)18-15-17-13(8-23-15)12-7-10(19)3-6-14(12)20/h1-8,19-20H,(H,17,18) |
| InChIKey | QOLJYABPYIZXJG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|