C18H17ClN2O5S2 — CID 3009168
4-chloro-N-[4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]benzenesulfonamide (PubChem CID 3009168) has the molecular formula C18H17ClN2O5S2 and a molecular weight of 440.93 g/mol. Its IUPAC name is 4-chloro-N-[4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3009168 |
| Molecular Formula | C18H17ClN2O5S2 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 4-chloro-N-[4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]benzenesulfonamide |
| SMILES | COc1cc(-c2csc(NS(=O)(=O)c3ccc(Cl)cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C18H17ClN2O5S2/c1-24-15-8-11(9-16(25-2)17(15)26-3)14-10-27-18(20-14)21-28(22,23)13-6-4-12(19)5-7-13/h4-10H,1-3H3,(H,20,21) |
| InChIKey | NKMCSRFMGOQYHC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|