C14H14N2O6S — CID 13177608
2-oxo-2-[[4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]amino]acetic acid (PubChem CID 13177608) has the molecular formula C14H14N2O6S and a molecular weight of 338.34 g/mol. Its IUPAC name is 2-oxo-2-[[4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]amino]acetic acid.
| Compound Name | 2-oxo-2-[[4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 13177608 |
| Molecular Formula | C14H14N2O6S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-oxo-2-[[4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]amino]acetic acid |
| SMILES | COc1cc(-c2csc(NC(=O)C(=O)O)n2)cc(OC)c1OC |
| InChI | InChI=1S/C14H14N2O6S/c1-20-9-4-7(5-10(21-2)11(9)22-3)8-6-23-14(15-8)16-12(17)13(18)19/h4-6H,1-3H3,(H,18,19)(H,15,16,17) |
| InChIKey | DQXWQXMZPFOFLI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|