C16H13N3O5S2 — CID 19203791
N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-nitrobenzenesulfonamide (PubChem CID 19203791) has the molecular formula C16H13N3O5S2 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 19203791 |
| Molecular Formula | C16H13N3O5S2 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-3-nitrobenzenesulfonamide |
| SMILES | COc1ccc(-c2csc(NS(=O)(=O)c3cccc([N+](=O)[O-])c3)n2)cc1 |
| InChI | InChI=1S/C16H13N3O5S2/c1-24-13-7-5-11(6-8-13)15-10-25-16(17-15)18-26(22,23)14-4-2-3-12(9-14)19(20)21/h2-10H,1H3,(H,17,18) |
| InChIKey | VVXRMYLEOXLEMQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|