C17H12N4O3S2 — CID 117071543
6-methoxy-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-1,3-benzothiazol-2-amine (PubChem CID 117071543) has the molecular formula C17H12N4O3S2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 6-methoxy-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-1,3-benzothiazol-2-amine.
| Compound Name | 6-methoxy-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 117071543 |
| Molecular Formula | C17H12N4O3S2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 6-methoxy-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc2nc(Nc3nc(-c4cccc([N+](=O)[O-])c4)cs3)sc2c1 |
| InChI | InChI=1S/C17H12N4O3S2/c1-24-12-5-6-13-15(8-12)26-17(18-13)20-16-19-14(9-25-16)10-3-2-4-11(7-10)21(22)23/h2-9H,1H3,(H,18,19,20) |
| InChIKey | QWIKOCVZOLKZFF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|