C20H17N5O3S — CID 167757390
N-[[1-(4-methoxyphenyl)pyrazol-3-yl]methyl]-4-(3-nitrophenyl)-1,3-thiazol-2-amine (PubChem CID 167757390) has the molecular formula C20H17N5O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is N-[[1-(4-methoxyphenyl)pyrazol-3-yl]methyl]-4-(3-nitrophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[[1-(4-methoxyphenyl)pyrazol-3-yl]methyl]-4-(3-nitrophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 167757390 |
| Molecular Formula | C20H17N5O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-[[1-(4-methoxyphenyl)pyrazol-3-yl]methyl]-4-(3-nitrophenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(-n2ccc(CNc3nc(-c4cccc([N+](=O)[O-])c4)cs3)n2)cc1 |
| InChI | InChI=1S/C20H17N5O3S/c1-28-18-7-5-16(6-8-18)24-10-9-15(23-24)12-21-20-22-19(13-29-20)14-3-2-4-17(11-14)25(26)27/h2-11,13H,12H2,1H3,(H,21,22) |
| InChIKey | DSKHBSFKWGRGBV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 95.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|