C16H11N3O3S — CID 19209639
6-methoxy-2-(3-nitrophenyl)imidazo[2,1-b][1,3]benzothiazole (PubChem CID 19209639) has the molecular formula C16H11N3O3S and a molecular weight of 325.35 g/mol. Its IUPAC name is 6-methoxy-2-(3-nitrophenyl)imidazo[2,1-b][1,3]benzothiazole.
| Compound Name | 6-methoxy-2-(3-nitrophenyl)imidazo[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 19209639 |
| Molecular Formula | C16H11N3O3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 6-methoxy-2-(3-nitrophenyl)imidazo[2,1-b][1,3]benzothiazole |
| SMILES | COc1ccc2c(c1)sc1nc(-c3cccc([N+](=O)[O-])c3)cn12 |
| InChI | InChI=1S/C16H11N3O3S/c1-22-12-5-6-14-15(8-12)23-16-17-13(9-18(14)16)10-3-2-4-11(7-10)19(20)21/h2-9H,1H3 |
| InChIKey | JPVGFCINSDCZDE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|