C21H18N4O4S — CID 41348992
N-(4-ethoxyphenyl)-3-methyl-6-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 41348992) has the molecular formula C21H18N4O4S and a molecular weight of 422.47 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-3-methyl-6-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-3-methyl-6-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 41348992 |
| Molecular Formula | C21H18N4O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | N-(4-ethoxyphenyl)-3-methyl-6-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2sc3nc(-c4cccc([N+](=O)[O-])c4)cn3c2C)cc1 |
| InChI | InChI=1S/C21H18N4O4S/c1-3-29-17-9-7-15(8-10-17)22-20(26)19-13(2)24-12-18(23-21(24)30-19)14-5-4-6-16(11-14)25(27)28/h4-12H,3H2,1-2H3,(H,22,26) |
| InChIKey | CBXJUFWAAGWGOC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|