C22H16N6O5S3 — CID 43953564
3-methyl-6-(3-nitrophenyl)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]imidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 43953564) has the molecular formula C22H16N6O5S3 and a molecular weight of 540.61 g/mol. Its IUPAC name is 3-methyl-6-(3-nitrophenyl)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]imidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | 3-methyl-6-(3-nitrophenyl)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]imidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 43953564 |
| Molecular Formula | C22H16N6O5S3 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.03 |
| IUPAC Name | 3-methyl-6-(3-nitrophenyl)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]imidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(S(=O)(=O)Nc3nccs3)cc2)sc2nc(-c3cccc([N+](=O)[O-])c3)cn12 |
| InChI | InChI=1S/C22H16N6O5S3/c1-13-19(35-22-25-18(12-27(13)22)14-3-2-4-16(11-14)28(30)31)20(29)24-15-5-7-17(8-6-15)36(32,33)26-21-23-9-10-34-21/h2-12H,1H3,(H,23,26)(H,24,29) |
| InChIKey | YVTYHUCYRRGXLP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 148.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|