C25H20N6O4S — CID 122262586
N-[[6-(4-methoxyphenyl)pyrimidin-4-yl]methyl]-3-methyl-6-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 122262586) has the molecular formula C25H20N6O4S and a molecular weight of 500.54 g/mol. Its IUPAC name is N-[[6-(4-methoxyphenyl)pyrimidin-4-yl]methyl]-3-methyl-6-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | N-[[6-(4-methoxyphenyl)pyrimidin-4-yl]methyl]-3-methyl-6-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 122262586 |
| Molecular Formula | C25H20N6O4S |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | N-[[6-(4-methoxyphenyl)pyrimidin-4-yl]methyl]-3-methyl-6-(3-nitrophenyl)imidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | COc1ccc(-c2cc(CNC(=O)c3sc4nc(-c5cccc([N+](=O)[O-])c5)cn4c3C)ncn2)cc1 |
| InChI | InChI=1S/C25H20N6O4S/c1-15-23(36-25-29-22(13-30(15)25)17-4-3-5-19(10-17)31(33)34)24(32)26-12-18-11-21(28-14-27-18)16-6-8-20(35-2)9-7-16/h3-11,13-14H,12H2,1-2H3,(H,26,32) |
| InChIKey | WKWBFEJCBDOYSI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|