C28H26N4O3S — CID 22523647
[2-(3-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 22523647) has the molecular formula C28H26N4O3S and a molecular weight of 498.61 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [2-(3-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 22523647 |
| Molecular Formula | C28H26N4O3S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | [2-(3-methoxyphenyl)imidazo[2,1-b][1,3]benzothiazol-6-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)c3ccc4c(c3)sc3nc(-c5cccc(OC)c5)cn34)CC2)cc1 |
| InChI | InChI=1S/C28H26N4O3S/c1-34-22-9-7-21(8-10-22)30-12-14-31(15-13-30)27(33)20-6-11-25-26(17-20)36-28-29-24(18-32(25)28)19-4-3-5-23(16-19)35-2/h3-11,16-18H,12-15H2,1-2H3 |
| InChIKey | JVAMZAMKHLIWAD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|