C23H17N3O2S — CID 1480560
N-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylphenyl)-4-methoxybenzamide (PubChem CID 1480560) has the molecular formula C23H17N3O2S and a molecular weight of 399.48 g/mol. Its IUPAC name is N-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylphenyl)-4-methoxybenzamide.
| Compound Name | N-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylphenyl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 1480560 |
| Molecular Formula | C23H17N3O2S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | N-(3-imidazo[2,1-b][1,3]benzothiazol-2-ylphenyl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(-c3cn4c(n3)sc3ccccc34)c2)cc1 |
| InChI | InChI=1S/C23H17N3O2S/c1-28-18-11-9-15(10-12-18)22(27)24-17-6-4-5-16(13-17)19-14-26-20-7-2-3-8-21(20)29-23(26)25-19/h2-14H,1H3,(H,24,27) |
| InChIKey | DEMXIQFCBMCCNA-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |