methyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate

C11H8N2O2S — CID 14067629

IUPACmethyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate
SMILESCOC(=O)c1cn2c(n1)sc1ccccc12
InChIInChI=1S/C11H8N2O2S/c1-15-10(14)7-6-13-8-4-2-3-5-9(8)16-11(13)12-7/h2-6H,1H3
InChIKeyRWSOTXIEORKMLT-UHFFFAOYSA-N
MW232.26 g/mol
LogP2.34
Rot. Bonds1

About methyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate

methyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate (PubChem CID 14067629) has the molecular formula C11H8N2O2S and a molecular weight of 232.26 g/mol. Its IUPAC name is methyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate.

Molecular Properties

Compound Namemethyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate
PubChem CID14067629
Molecular FormulaC11H8N2O2S
Molecular Weight232.26 g/mol
Exact Mass232.03
IUPAC Namemethyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate
SMILESCOC(=O)c1cn2c(n1)sc1ccccc12
InChIInChI=1S/C11H8N2O2S/c1-15-10(14)7-6-13-8-4-2-3-5-9(8)16-11(13)12-7/h2-6H,1H3
InChIKeyRWSOTXIEORKMLT-UHFFFAOYSA-N
XLogP2.34
TPSA43.60 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.26
LogP ≤ 52.34
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate?
The IUPAC name of methyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate (CID 14067629) is methyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate.
What is the SMILES notation for methyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate?
The canonical SMILES for methyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate is COC(=O)c1cn2c(n1)sc1ccccc12.
What is the InChIKey of methyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate?
The InChIKey is RWSOTXIEORKMLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O2S/c1-15-10(14)7-6-13-8-4-2-3-5-9(8)16-11(13)12-7/h2-6H,1H3.
What are the key properties of methyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate?
methyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate has a molecular weight of 232.26 g/mol, XLogP of 2.34, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl imidazo[2,1-b][1,3]benzothiazole-2-carboxylate is sourced from PubChem (CID 14067629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).