C12H8F3N3O2S2 — CID 145044061
N-methylsulfanyl-6-(trifluoromethoxy)imidazo[2,1-b][1,3]benzothiazole-2-carboxamide (PubChem CID 145044061) has the molecular formula C12H8F3N3O2S2 and a molecular weight of 347.34 g/mol. Its IUPAC name is N-methylsulfanyl-6-(trifluoromethoxy)imidazo[2,1-b][1,3]benzothiazole-2-carboxamide.
| Compound Name | N-methylsulfanyl-6-(trifluoromethoxy)imidazo[2,1-b][1,3]benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 145044061 |
| Molecular Formula | C12H8F3N3O2S2 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | N-methylsulfanyl-6-(trifluoromethoxy)imidazo[2,1-b][1,3]benzothiazole-2-carboxamide |
| SMILES | CSNC(=O)c1cn2c(n1)sc1cc(OC(F)(F)F)ccc12 |
| InChI | InChI=1S/C12H8F3N3O2S2/c1-21-17-10(19)7-5-18-8-3-2-6(20-12(13,14)15)4-9(8)22-11(18)16-7/h2-5H,1H3,(H,17,19) |
| InChIKey | HHVGIBNVPUOBRB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|