About 7-chloro-6-(trifluoromethoxy)imidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid
7-chloro-6-(trifluoromethoxy)imidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid (PubChem CID 118971303) has the molecular formula C11H4ClF3N2O3S
and a molecular weight of 336.68 g/mol. Its IUPAC name is 7-chloro-6-(trifluoromethoxy)imidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid.
Molecular Properties
| Compound Name | 7-chloro-6-(trifluoromethoxy)imidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid |
| PubChem CID | 118971303 |
| Molecular Formula | C11H4ClF3N2O3S |
| Molecular Weight | 336.68 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 7-chloro-6-(trifluoromethoxy)imidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid |
| SMILES | O=C(O)c1cn2c(n1)sc1cc(OC(F)(F)F)c(Cl)cc12 |
| InChI | InChI=1S/C11H4ClF3N2O3S/c12-4-1-6-8(2-7(4)20-11(13,14)15)21-10-16-5(9(18)19)3-17(6)10/h1-3H,(H,18,19) |
| InChIKey | BBQXMSQNDIPJFP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.68 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-chloro-6-(trifluoromethoxy)imidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-6-(trifluoromethoxy)imidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid?
The IUPAC name of 7-chloro-6-(trifluoromethoxy)imidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid (CID 118971303) is 7-chloro-6-(trifluoromethoxy)imidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid.
What is the SMILES notation for 7-chloro-6-(trifluoromethoxy)imidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid?
The canonical SMILES for 7-chloro-6-(trifluoromethoxy)imidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid is O=C(O)c1cn2c(n1)sc1cc(OC(F)(F)F)c(Cl)cc12.
What is the InChIKey of 7-chloro-6-(trifluoromethoxy)imidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid?
The InChIKey is BBQXMSQNDIPJFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H4ClF3N2O3S/c12-4-1-6-8(2-7(4)20-11(13,14)15)21-10-16-5(9(18)19)3-17(6)10/h1-3H,(H,18,19).
What are the key properties of 7-chloro-6-(trifluoromethoxy)imidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid?
7-chloro-6-(trifluoromethoxy)imidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid has a molecular weight of 336.68 g/mol, XLogP of 3.80, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-6-(trifluoromethoxy)imidazo[2,1-b][1,3]benzothiazole-2-carboxylic acid is sourced from PubChem (CID 118971303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).