About methyl 6-bromoimidazo[2,1-b][1,3]benzothiazole-2-carboxylate
methyl 6-bromoimidazo[2,1-b][1,3]benzothiazole-2-carboxylate (PubChem CID 122367514) has the molecular formula C11H7BrN2O2S
and a molecular weight of 311.16 g/mol. Its IUPAC name is methyl 6-bromoimidazo[2,1-b][1,3]benzothiazole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-bromoimidazo[2,1-b][1,3]benzothiazole-2-carboxylate |
| PubChem CID | 122367514 |
| Molecular Formula | C11H7BrN2O2S |
| Molecular Weight | 311.16 g/mol |
| Exact Mass | 309.94 |
| IUPAC Name | methyl 6-bromoimidazo[2,1-b][1,3]benzothiazole-2-carboxylate |
| SMILES | COC(=O)c1cn2c(n1)sc1cc(Br)ccc12 |
| InChI | InChI=1S/C11H7BrN2O2S/c1-16-10(15)7-5-14-8-3-2-6(12)4-9(8)17-11(14)13-7/h2-5H,1H3 |
| InChIKey | CPVTVMURZNIYJR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.16 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 6-bromoimidazo[2,1-b][1,3]benzothiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-bromoimidazo[2,1-b][1,3]benzothiazole-2-carboxylate?
The IUPAC name of methyl 6-bromoimidazo[2,1-b][1,3]benzothiazole-2-carboxylate (CID 122367514) is methyl 6-bromoimidazo[2,1-b][1,3]benzothiazole-2-carboxylate.
What is the SMILES notation for methyl 6-bromoimidazo[2,1-b][1,3]benzothiazole-2-carboxylate?
The canonical SMILES for methyl 6-bromoimidazo[2,1-b][1,3]benzothiazole-2-carboxylate is COC(=O)c1cn2c(n1)sc1cc(Br)ccc12.
What is the InChIKey of methyl 6-bromoimidazo[2,1-b][1,3]benzothiazole-2-carboxylate?
The InChIKey is CPVTVMURZNIYJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BrN2O2S/c1-16-10(15)7-5-14-8-3-2-6(12)4-9(8)17-11(14)13-7/h2-5H,1H3.
What are the key properties of methyl 6-bromoimidazo[2,1-b][1,3]benzothiazole-2-carboxylate?
methyl 6-bromoimidazo[2,1-b][1,3]benzothiazole-2-carboxylate has a molecular weight of 311.16 g/mol, XLogP of 3.10, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-bromoimidazo[2,1-b][1,3]benzothiazole-2-carboxylate is sourced from PubChem (CID 122367514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).