C14H9ClF3NO4 — CID 154631856
6-chloro-1-cyclopropyl-4-oxo-7-(trifluoromethoxy)quinoline-3-carboxylic acid (PubChem CID 154631856) has the molecular formula C14H9ClF3NO4 and a molecular weight of 347.68 g/mol. Its IUPAC name is 6-chloro-1-cyclopropyl-4-oxo-7-(trifluoromethoxy)quinoline-3-carboxylic acid.
| Compound Name | 6-chloro-1-cyclopropyl-4-oxo-7-(trifluoromethoxy)quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 154631856 |
| Molecular Formula | C14H9ClF3NO4 |
| Molecular Weight | 347.68 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 6-chloro-1-cyclopropyl-4-oxo-7-(trifluoromethoxy)quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CC2)c2cc(OC(F)(F)F)c(Cl)cc2c1=O |
| InChI | InChI=1S/C14H9ClF3NO4/c15-9-3-7-10(4-11(9)23-14(16,17)18)19(6-1-2-6)5-8(12(7)20)13(21)22/h3-6H,1-2H2,(H,21,22) |
| InChIKey | VXVJMWMKELKCEG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.68 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |