C15H11F4NO5S — CID 20619484
(3-acetyl-1-cyclopropyl-6-fluoro-4-oxoquinolin-7-yl) trifluoromethanesulfonate (PubChem CID 20619484) has the molecular formula C15H11F4NO5S and a molecular weight of 393.31 g/mol. Its IUPAC name is (3-acetyl-1-cyclopropyl-6-fluoro-4-oxoquinolin-7-yl) trifluoromethanesulfonate.
| Compound Name | (3-acetyl-1-cyclopropyl-6-fluoro-4-oxoquinolin-7-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 20619484 |
| Molecular Formula | C15H11F4NO5S |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | (3-acetyl-1-cyclopropyl-6-fluoro-4-oxoquinolin-7-yl) trifluoromethanesulfonate |
| SMILES | CC(=O)c1cn(C2CC2)c2cc(OS(=O)(=O)C(F)(F)F)c(F)cc2c1=O |
| InChI | InChI=1S/C15H11F4NO5S/c1-7(21)10-6-20(8-2-3-8)12-5-13(11(16)4-9(12)14(10)22)25-26(23,24)15(17,18)19/h4-6,8H,2-3H2,1H3 |
| InChIKey | AJHNIDIZMPTKQN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 82.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|