C12H6Cl2F3N3OS2 — CID 145044074
5,6-dichloro-N-(2,2,2-trifluoroethylsulfanyl)imidazo[2,1-b][1,3]benzothiazole-2-carboxamide (PubChem CID 145044074) has the molecular formula C12H6Cl2F3N3OS2 and a molecular weight of 400.23 g/mol. Its IUPAC name is 5,6-dichloro-N-(2,2,2-trifluoroethylsulfanyl)imidazo[2,1-b][1,3]benzothiazole-2-carboxamide.
| Compound Name | 5,6-dichloro-N-(2,2,2-trifluoroethylsulfanyl)imidazo[2,1-b][1,3]benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 145044074 |
| Molecular Formula | C12H6Cl2F3N3OS2 |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 398.93 |
| IUPAC Name | 5,6-dichloro-N-(2,2,2-trifluoroethylsulfanyl)imidazo[2,1-b][1,3]benzothiazole-2-carboxamide |
| SMILES | O=C(NSCC(F)(F)F)c1cn2c(n1)sc1c(Cl)c(Cl)ccc12 |
| InChI | InChI=1S/C12H6Cl2F3N3OS2/c13-5-1-2-7-9(8(5)14)23-11-18-6(3-20(7)11)10(21)19-22-4-12(15,16)17/h1-3H,4H2,(H,19,21) |
| InChIKey | YQLMGWVKIRWBEN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|