About 3-methyl-2-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-6-carbonyl chloride
3-methyl-2-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-6-carbonyl chloride (PubChem CID 125473959) has the molecular formula C8H4ClF3N2OS
and a molecular weight of 268.65 g/mol. Its IUPAC name is 3-methyl-2-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-6-carbonyl chloride.
Molecular Properties
| Compound Name | 3-methyl-2-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-6-carbonyl chloride |
| PubChem CID | 125473959 |
| Molecular Formula | C8H4ClF3N2OS |
| Molecular Weight | 268.65 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 3-methyl-2-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-6-carbonyl chloride |
| SMILES | Cc1c(C(F)(F)F)sc2nc(C(=O)Cl)cn12 |
| InChI | InChI=1S/C8H4ClF3N2OS/c1-3-5(8(10,11)12)16-7-13-4(6(9)15)2-14(3)7/h2H,1H3 |
| InChIKey | KNKJPHSDGHBSMK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.65 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-6-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-6-carbonyl chloride?
The IUPAC name of 3-methyl-2-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-6-carbonyl chloride (CID 125473959) is 3-methyl-2-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-6-carbonyl chloride.
What is the SMILES notation for 3-methyl-2-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-6-carbonyl chloride?
The canonical SMILES for 3-methyl-2-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-6-carbonyl chloride is Cc1c(C(F)(F)F)sc2nc(C(=O)Cl)cn12.
What is the InChIKey of 3-methyl-2-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-6-carbonyl chloride?
The InChIKey is KNKJPHSDGHBSMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClF3N2OS/c1-3-5(8(10,11)12)16-7-13-4(6(9)15)2-14(3)7/h2H,1H3.
What are the key properties of 3-methyl-2-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-6-carbonyl chloride?
3-methyl-2-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-6-carbonyl chloride has a molecular weight of 268.65 g/mol, XLogP of 3.10, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-6-carbonyl chloride is sourced from PubChem (CID 125473959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).