C10H12N2O2S — CID 3592722
3-tert-butylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid (PubChem CID 3592722) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 3-tert-butylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid.
| Compound Name | 3-tert-butylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 3592722 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 3-tert-butylimidazo[2,1-b][1,3]thiazole-6-carboxylic acid |
| SMILES | CC(C)(C)c1csc2nc(C(=O)O)cn12 |
| InChI | InChI=1S/C10H12N2O2S/c1-10(2,3)7-5-15-9-11-6(8(13)14)4-12(7)9/h4-5H,1-3H3,(H,13,14) |
| InChIKey | XQVDKPOJYPVQKX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |