C7H2ClF3N2OS — CID 125474072
3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-6-carbonyl chloride (PubChem CID 125474072) has the molecular formula C7H2ClF3N2OS and a molecular weight of 254.62 g/mol. Its IUPAC name is 3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-6-carbonyl chloride.
| Compound Name | 3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-6-carbonyl chloride |
|---|---|
| PubChem CID | 125474072 |
| Molecular Formula | C7H2ClF3N2OS |
| Molecular Weight | 254.62 g/mol |
| Exact Mass | 253.95 |
| IUPAC Name | 3-(trifluoromethyl)imidazo[2,1-b][1,3]thiazole-6-carbonyl chloride |
| SMILES | O=C(Cl)c1cn2c(C(F)(F)F)csc2n1 |
| InChI | InChI=1S/C7H2ClF3N2OS/c8-5(14)3-1-13-4(7(9,10)11)2-15-6(13)12-3/h1-2H |
| InChIKey | WJBKLJODXNQGMF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.62 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|